Itselliekojo10121 Itselliekojo10121

11-03-2024
Medicine

contestada

What would confirm a diagnosis of Hodgkin lymphoma?
1) Pruritus
2) Leukopenia
3) Reed-Sternberg cell
4) Thrombocytopenia

Respuesta :

Otras preguntas

please explain how you got your answer(:

What did George Washington want the United States to stay out the foreign wars

A car is traveling at a speed of 57 miles per hour .what is the the cars speed in miles per minute?

What factor most influence the rate of molecular movement into a cell?

How will the mass of a rusted iron nail compare with the mass of the same nail before it rusted? A. The two masses will be the same. B. The rusted nail will

Alright I have a 83.3% in Science which is a B+. If on a test I get 98%, and on another assignment I get 100%. What would my grade be now?

Which is bigger 4.510 or 4.51

Find the 11th partial sum of the summation of negative 7i plus 22, from i equals 1 to infinity. -220 400 550 -700

Show that cos(A+45)=cos45(cosA-sinA)

a bag used to apply icing to a cake is in the shape of a cone with a diameter of 6in. and a height of 10in. how much will this bag hold when full?