pickleglocck pickleglocck

11-06-2020
Mathematics

contestada

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)

Respuesta :

yeetosaurus69 yeetosaurus69

11-06-2020

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer Link

udhayabrol udhayabrol

26-07-2020

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

Answer Link

Otras preguntas

Someone please help me

True or False: Parasites use the host's fluids/tissues for nutrients.

Summary of “Animal Wisdom” by Nancy Wood

what is ''the cloud''

In analyzing how the poem started with a rhetorical question you are looking at what aspect of the literary text? A. Form B. Setting C. Structure D. Symbol

AABC has vertices at A(1, 1), B(4,5) and C(6,2). If the figures is reflected over the x-axis, what are the coordinates of the vertices of triangle A'B'C? A. A'(

warren g. harding won office by campaigning on which theme

the primary difference between the periodic and perpetual inventory systems is that a

Indicate if the statement is true or false False 1. A spreadsheet cannot recalculate after you have changed data in your worksheet. 2. A spreadsheet uses formul

I NEED HELPPPPPPPPPPPPPPPPPPPP ------------------------------------------------------------ Determine the meaning of each figurative statement. 1. I am a rock,/