BBrenija
BBrenija BBrenija
  • 12-03-2021
  • Mathematics
contestada

can someone help xoxo

can someone help xoxo class=

Respuesta :

skylx
skylx skylx
  • 12-03-2021
it’s B since gail isn’t getting close to her home
Answer Link

Otras preguntas

When medical professionals talk about the abdomen, they divide it into four sections, or abdominopelvic quadrants. These four imaginary sections meet at a singl
What physical process changed the geological area
A computer with a domain name is called what?
The image of (-2, 5) is (1, 1) What is the image of (3, 2) under the same translation?
Show that cos(A+45)=cos45(cosA-sinA)
A pure compound contains 24 g C, 4 g H, and 32 g O. If no other elements are present, determine the empirical formula of the compound. Be sure to show your work
Suppose you cut a small square from a square of fabric as shown in the diagram. Write an expression for the remaining shaded area.
plz show work and explain
What is the LEAST amount of information you need about a pair of triangles to be SURE they are congruent?
If f(x) = x^2 + 9x, find f(a - 4)